C21H29NO2 — CID 8990543
N-[(2R)-2-(1-adamantyloxy)propyl]-4-methylbenzamide (PubChem CID 8990543) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-[(2R)-2-(1-adamantyloxy)propyl]-4-methylbenzamide.
| Compound Name | N-[(2R)-2-(1-adamantyloxy)propyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 8990543 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | N-[(2R)-2-(1-adamantyloxy)propyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC[C@@H](C)OC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-14-3-5-19(6-4-14)20(23)22-13-15(2)24-21-10-16-7-17(11-21)9-18(8-16)12-21/h3-6,15-18H,7-13H2,1-2H3,(H,22,23)/t15-,16?,17?,18?,21?/m1/s1 |
| InChIKey | OIERFJRCUWHLOI-NEFAXPCMSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |