C22H32N2O4S — CID 7319718
N-[(2S)-2-(1-adamantyloxy)propyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 7319718) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[(2S)-2-(1-adamantyloxy)propyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[(2S)-2-(1-adamantyloxy)propyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 7319718 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[(2S)-2-(1-adamantyloxy)propyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | C[C@@H](CNC(=O)c1ccc(S(=O)(=O)N(C)C)cc1)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H32N2O4S/c1-15(28-22-11-16-8-17(12-22)10-18(9-16)13-22)14-23-21(25)19-4-6-20(7-5-19)29(26,27)24(2)3/h4-7,15-18H,8-14H2,1-3H3,(H,23,25)/t15-,16?,17?,18?,22?/m0/s1 |
| InChIKey | WXRKJXBTAVRQIP-BZSISCHUSA-N |
| XLogP | 3.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |