C14H19NO4S — CID 63319990
N,N-dimethyl-4-(4-methyl-3-oxopentanoyl)benzenesulfonamide (PubChem CID 63319990) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methyl-3-oxopentanoyl)benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-(4-methyl-3-oxopentanoyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63319990 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N,N-dimethyl-4-(4-methyl-3-oxopentanoyl)benzenesulfonamide |
| SMILES | CC(C)C(=O)CC(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-10(2)13(16)9-14(17)11-5-7-12(8-6-11)20(18,19)15(3)4/h5-8,10H,9H2,1-4H3 |
| InChIKey | DFGCRINGZOPXOS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|