C12H15N2O5S- — CID 9441553
(2S)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]propanoate (PubChem CID 9441553) has the molecular formula C12H15N2O5S- and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]propanoate.
| Compound Name | (2S)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 9441553 |
| Molecular Formula | C12H15N2O5S- |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (2S)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc(S(=O)(=O)N(C)C)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H16N2O5S/c1-8(12(16)17)13-11(15)9-4-6-10(7-5-9)20(18,19)14(2)3/h4-8H,1-3H3,(H,13,15)(H,16,17)/p-1/t8-/m0/s1 |
| InChIKey | VSEQOHQIPUQVGA-QMMMGPOBSA-M |
| XLogP | -1.19 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |