C15H21N2O5S- — CID 9441550
(2R)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoate (PubChem CID 9441550) has the molecular formula C15H21N2O5S- and a molecular weight of 341.41 g/mol. Its IUPAC name is (2R)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoate.
| Compound Name | (2R)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 9441550 |
| Molecular Formula | C15H21N2O5S- |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2R)-2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)c1ccc(S(=O)(=O)N(C)C)cc1)C(=O)[O-] |
| InChI | InChI=1S/C15H22N2O5S/c1-10(2)9-13(15(19)20)16-14(18)11-5-7-12(8-6-11)23(21,22)17(3)4/h5-8,10,13H,9H2,1-4H3,(H,16,18)(H,19,20)/p-1/t13-/m1/s1 |
| InChIKey | REYIJKFOYHUVPX-CYBMUJFWSA-M |
| XLogP | -0.17 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |