C20H29N2O5S- — CID 9402257
(2S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-4-methylpentanoate (PubChem CID 9402257) has the molecular formula C20H29N2O5S- and a molecular weight of 409.53 g/mol. Its IUPAC name is (2S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-4-methylpentanoate.
| Compound Name | (2S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 9402257 |
| Molecular Formula | C20H29N2O5S- |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)c1cccc(S(=O)(=O)N(C)C2CCCCC2)c1)C(=O)[O-] |
| InChI | InChI=1S/C20H30N2O5S/c1-14(2)12-18(20(24)25)21-19(23)15-8-7-11-17(13-15)28(26,27)22(3)16-9-5-4-6-10-16/h7-8,11,13-14,16,18H,4-6,9-10,12H2,1-3H3,(H,21,23)(H,24,25)/p-1/t18-/m0/s1 |
| InChIKey | HHULYIVPCGNGPI-SFHVURJKSA-M |
| XLogP | 1.53 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |