C18H26N2O6S — CID 25489125
(2S,3S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-hydroxybutanoic acid (PubChem CID 25489125) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is (2S,3S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 25489125 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2S,3S)-2-[[3-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-3-hydroxybutanoic acid |
| SMILES | C[C@H](O)[C@H](NC(=O)c1cccc(S(=O)(=O)N(C)C2CCCCC2)c1)C(=O)O |
| InChI | InChI=1S/C18H26N2O6S/c1-12(21)16(18(23)24)19-17(22)13-7-6-10-15(11-13)27(25,26)20(2)14-8-4-3-5-9-14/h6-7,10-12,14,16,21H,3-5,8-9H2,1-2H3,(H,19,22)(H,23,24)/t12-,16-/m0/s1 |
| InChIKey | ZNYBBFSCYGWCGR-LRDDRELGSA-N |
| XLogP | 1.20 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |