C20H23NO2 — CID 766020
N-[3-(3,4-dimethylbenzoyl)phenyl]-3-methylbutanamide (PubChem CID 766020) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[3-(3,4-dimethylbenzoyl)phenyl]-3-methylbutanamide.
| Compound Name | N-[3-(3,4-dimethylbenzoyl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 766020 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[3-(3,4-dimethylbenzoyl)phenyl]-3-methylbutanamide |
| SMILES | Cc1ccc(C(=O)c2cccc(NC(=O)CC(C)C)c2)cc1C |
| InChI | InChI=1S/C20H23NO2/c1-13(2)10-19(22)21-18-7-5-6-16(12-18)20(23)17-9-8-14(3)15(4)11-17/h5-9,11-13H,10H2,1-4H3,(H,21,22) |
| InChIKey | YRNRBUDDYYSBGX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |