C16H14F3NO3S — CID 71388181
N-[3-(3,4-dimethylbenzoyl)phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 71388181) has the molecular formula C16H14F3NO3S and a molecular weight of 357.35 g/mol. Its IUPAC name is N-[3-(3,4-dimethylbenzoyl)phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[3-(3,4-dimethylbenzoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 71388181 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[3-(3,4-dimethylbenzoyl)phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Cc1ccc(C(=O)c2cccc(NS(=O)(=O)C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C16H14F3NO3S/c1-10-6-7-13(8-11(10)2)15(21)12-4-3-5-14(9-12)20-24(22,23)16(17,18)19/h3-9,20H,1-2H3 |
| InChIKey | KXSYNKNQSAARPD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |