C22H16BrNO3 — CID 28668650
5-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]naphthalene-1-carboxamide (PubChem CID 28668650) has the molecular formula C22H16BrNO3 and a molecular weight of 422.28 g/mol. Its IUPAC name is 5-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 28668650 |
| Molecular Formula | C22H16BrNO3 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 5-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]phenyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccc(CO)o2)c1)c1cccc2c(Br)cccc12 |
| InChI | InChI=1S/C22H16BrNO3/c23-20-9-3-6-17-18(20)7-2-8-19(17)22(26)24-15-5-1-4-14(12-15)21-11-10-16(13-25)27-21/h1-12,25H,13H2,(H,24,26) |
| InChIKey | NRRJJYVMUCSBDU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |