C20H19BrFNO4 — CID 55686063
ethyl 3-[4-[2-(2-bromo-4-fluorophenoxy)propanoylamino]phenyl]prop-2-enoate (PubChem CID 55686063) has the molecular formula C20H19BrFNO4 and a molecular weight of 436.28 g/mol. Its IUPAC name is ethyl 3-[4-[2-(2-bromo-4-fluorophenoxy)propanoylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[2-(2-bromo-4-fluorophenoxy)propanoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55686063 |
| Molecular Formula | C20H19BrFNO4 |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | ethyl 3-[4-[2-(2-bromo-4-fluorophenoxy)propanoylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(NC(=O)C(C)Oc2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C20H19BrFNO4/c1-3-26-19(24)11-6-14-4-8-16(9-5-14)23-20(25)13(2)27-18-10-7-15(22)12-17(18)21/h4-13H,3H2,1-2H3,(H,23,25) |
| InChIKey | IUBPHQBFHNTDJN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|