C15H24N4O5S — CID 36587541
2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-(ethylcarbamoyl)acetamide (PubChem CID 36587541) has the molecular formula C15H24N4O5S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 36587541 |
| Molecular Formula | C15H24N4O5S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CNc1ccc(OCC)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H24N4O5S/c1-5-16-15(21)18-14(20)10-17-11-7-8-12(24-6-2)13(9-11)25(22,23)19(3)4/h7-9,17H,5-6,10H2,1-4H3,(H2,16,18,20,21) |
| InChIKey | TUDKZFRLIDEARH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|