C20H30N4O4S — CID 55626665
N-(1-cyanocyclohexyl)-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-methylacetamide (PubChem CID 55626665) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-methylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-methylacetamide |
|---|---|
| PubChem CID | 55626665 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-methylacetamide |
| SMILES | CCOc1ccc(NCC(=O)N(C)C2(C#N)CCCCC2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H30N4O4S/c1-5-28-17-10-9-16(13-18(17)29(26,27)23(2)3)22-14-19(25)24(4)20(15-21)11-7-6-8-12-20/h9-10,13,22H,5-8,11-12,14H2,1-4H3 |
| InChIKey | AKCXVWOUOPQNET-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|