C21H29N3O6S — CID 55565700
N-[(3,4-dimethoxyphenyl)methyl]-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetamide (PubChem CID 55565700) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetamide |
|---|---|
| PubChem CID | 55565700 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]acetamide |
| SMILES | CCOc1ccc(NCC(=O)NCc2ccc(OC)c(OC)c2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H29N3O6S/c1-6-30-18-10-8-16(12-20(18)31(26,27)24(2)3)22-14-21(25)23-13-15-7-9-17(28-4)19(11-15)29-5/h7-12,22H,6,13-14H2,1-5H3,(H,23,25) |
| InChIKey | ACHMBFGFYSXHKG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|