C19H27N3O5S2 — CID 55566308
5-[[3-(dimethylsulfamoyl)phenyl]methylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 55566308) has the molecular formula C19H27N3O5S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 5-[[3-(dimethylsulfamoyl)phenyl]methylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 5-[[3-(dimethylsulfamoyl)phenyl]methylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55566308 |
| Molecular Formula | C19H27N3O5S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 5-[[3-(dimethylsulfamoyl)phenyl]methylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CCOc1ccc(NCc2cccc(S(=O)(=O)N(C)C)c2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H27N3O5S2/c1-6-27-18-11-10-16(13-19(18)29(25,26)22(4)5)20-14-15-8-7-9-17(12-15)28(23,24)21(2)3/h7-13,20H,6,14H2,1-5H3 |
| InChIKey | OPUNZRKUQNYBBQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|