C16H19BrN2O5S2 — CID 26267785
5-[(2-bromophenyl)sulfonylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 26267785) has the molecular formula C16H19BrN2O5S2 and a molecular weight of 463.38 g/mol. Its IUPAC name is 5-[(2-bromophenyl)sulfonylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 5-[(2-bromophenyl)sulfonylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26267785 |
| Molecular Formula | C16H19BrN2O5S2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 5-[(2-bromophenyl)sulfonylamino]-2-ethoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccccc2Br)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H19BrN2O5S2/c1-4-24-14-10-9-12(11-16(14)26(22,23)19(2)3)18-25(20,21)15-8-6-5-7-13(15)17/h5-11,18H,4H2,1-3H3 |
| InChIKey | FPPFGTGQEFQBMQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |