C20H27N3O4S — CID 37218709
2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-ethyl-N-phenylacetamide (PubChem CID 37218709) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-ethyl-N-phenylacetamide.
| Compound Name | 2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 37218709 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]-N-ethyl-N-phenylacetamide |
| SMILES | CCOc1ccc(NCC(=O)N(CC)c2ccccc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H27N3O4S/c1-5-23(17-10-8-7-9-11-17)20(24)15-21-16-12-13-18(27-6-2)19(14-16)28(25,26)22(3)4/h7-14,21H,5-6,15H2,1-4H3 |
| InChIKey | ZQQZRJQHQYOPKG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|