C21H26N2O4S3 — CID 26421884
N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-(1,3-dithian-2-yl)benzamide (PubChem CID 26421884) has the molecular formula C21H26N2O4S3 and a molecular weight of 466.65 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-(1,3-dithian-2-yl)benzamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-(1,3-dithian-2-yl)benzamide |
|---|---|
| PubChem CID | 26421884 |
| Molecular Formula | C21H26N2O4S3 |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-4-(1,3-dithian-2-yl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(C3SCCCS3)cc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H26N2O4S3/c1-4-27-18-11-10-17(14-19(18)30(25,26)23(2)3)22-20(24)15-6-8-16(9-7-15)21-28-12-5-13-29-21/h6-11,14,21H,4-5,12-13H2,1-3H3,(H,22,24) |
| InChIKey | NEMFHBAFAMOHBH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |