C33H24N2O6 — CID 3908081
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate (PubChem CID 3908081) has the molecular formula C33H24N2O6 and a molecular weight of 544.56 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 3908081 |
| Molecular Formula | C33H24N2O6 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OC(C(=O)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C33H24N2O6/c1-40-28-16-15-20(19-35-31(37)23-12-5-6-13-24(23)32(35)38)17-25(28)33(39)41-30(21-9-3-2-4-10-21)29(36)26-18-34-27-14-8-7-11-22(26)27/h2-18,30,34H,19H2,1H3 |
| InChIKey | FGYMRPRZGYCCKJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|