C26H23NO5 — CID 3388091
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(2-methoxy-4-methylphenoxy)acetate (PubChem CID 3388091) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(2-methoxy-4-methylphenoxy)acetate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(2-methoxy-4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 3388091 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(2-methoxy-4-methylphenoxy)acetate |
| SMILES | COc1cc(C)ccc1OCC(=O)OC(C(=O)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H23NO5/c1-17-12-13-22(23(14-17)30-2)31-16-24(28)32-26(18-8-4-3-5-9-18)25(29)20-15-27-21-11-7-6-10-19(20)21/h3-15,26-27H,16H2,1-2H3 |
| InChIKey | RBNSDXBNJBJSOH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |