C25H20N2O7 — CID 4683135
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 4683135) has the molecular formula C25H20N2O7 and a molecular weight of 460.44 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 4683135 |
| Molecular Formula | C25H20N2O7 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OC(C(=O)c2c[nH]c3ccccc23)c2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H20N2O7/c1-32-21-12-17(20(27(30)31)13-22(21)33-2)25(29)34-24(15-8-4-3-5-9-15)23(28)18-14-26-19-11-7-6-10-16(18)19/h3-14,24,26H,1-2H3 |
| InChIKey | BRWRUSXVWJXOTF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|