C30H26N2O5 — CID 3891968
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 3891968) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 3891968 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OC(C(=O)c1c[nH]c2ccccc12)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H26N2O5/c1-18(2)16-25(32-28(34)21-13-6-7-14-22(21)29(32)35)30(36)37-27(19-10-4-3-5-11-19)26(33)23-17-31-24-15-9-8-12-20(23)24/h3-15,17-18,25,27,31H,16H2,1-2H3 |
| InChIKey | LEYXLFCYKBJBPQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|