About phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride
phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride (PubChem CID 156853470) has the molecular formula C16H16ClNO3S
and a molecular weight of 337.83 g/mol. Its IUPAC name is phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride |
| PubChem CID | 156853470 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride |
| SMILES | Cl.O.O=C(OCSc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H13NO2S.ClH.H2O/c18-16(19-11-20-12-6-2-1-3-7-12)14-10-17-15-9-5-4-8-13(14)15;;/h1-10,17H,11H2;1H;1H2 |
| InChIKey | FIKZREPHQGIYPD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
The IUPAC name of phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride (CID 156853470) is phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride.
What is the SMILES notation for phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
The canonical SMILES for phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride is Cl.O.O=C(OCSc1ccccc1)c1c[nH]c2ccccc12.
What is the InChIKey of phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
The InChIKey is FIKZREPHQGIYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S.ClH.H2O/c18-16(19-11-20-12-6-2-1-3-7-12)14-10-17-15-9-5-4-8-13(14)15;;/h1-10,17H,11H2;1H;1H2.
What are the key properties of phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride?
phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride has a molecular weight of 337.83 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylmethyl 1H-indole-3-carboxylate;hydrate;hydrochloride is sourced from PubChem (CID 156853470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).