About [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate
[2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate (PubChem CID 3362624) has the molecular formula C18H15NO3S
and a molecular weight of 325.39 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate |
| PubChem CID | 3362624 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OCC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15NO3S/c20-17(15-10-19-16-9-5-4-8-14(15)16)11-22-18(21)12-23-13-6-2-1-3-7-13/h1-10,19H,11-12H2 |
| InChIKey | DGYVGSXRUZAVIM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate?
The IUPAC name of [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate (CID 3362624) is [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate.
What is the SMILES notation for [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate?
The canonical SMILES for [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate is O=C(CSc1ccccc1)OCC(=O)c1c[nH]c2ccccc12.
What is the InChIKey of [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate?
The InChIKey is DGYVGSXRUZAVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3S/c20-17(15-10-19-16-9-5-4-8-14(15)16)11-22-18(21)12-23-13-6-2-1-3-7-13/h1-10,19H,11-12H2.
What are the key properties of [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate?
[2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate has a molecular weight of 325.39 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indol-3-yl)-2-oxoethyl] 2-phenylsulfanylacetate is sourced from PubChem (CID 3362624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).