C21H23NO5S — CID 8587247
ethyl 5-ethyl-2-[[2-(1-phenylcyclopropanecarbonyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 8587247) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[[2-(1-phenylcyclopropanecarbonyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[[2-(1-phenylcyclopropanecarbonyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8587247 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | ethyl 5-ethyl-2-[[2-(1-phenylcyclopropanecarbonyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)COC(=O)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23NO5S/c1-3-15-12-16(19(24)26-4-2)18(28-15)22-17(23)13-27-20(25)21(10-11-21)14-8-6-5-7-9-14/h5-9,12H,3-4,10-11,13H2,1-2H3,(H,22,23) |
| InChIKey | RYMJCQJDBRJUAR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |