C20H19ClFNO5 — CID 7880581
ethyl 4-[2-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 7880581) has the molecular formula C20H19ClFNO5 and a molecular weight of 407.83 g/mol. Its IUPAC name is ethyl 4-[2-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-[2-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7880581 |
| Molecular Formula | C20H19ClFNO5 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 4-[2-[(E)-3-(3-chloro-4-fluorophenyl)prop-2-enoyl]oxyacetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1C(=O)COC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClFNO5/c1-4-27-20(26)19-12(3)23-11(2)18(19)16(24)10-28-17(25)8-6-13-5-7-15(22)14(21)9-13/h5-9,23H,4,10H2,1-3H3/b8-6+ |
| InChIKey | QLCRVWQKOQTPQJ-SOFGYWHQSA-N |
| XLogP | 4.04 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|