C19H24N2O6S — CID 9094543
methyl 4-[(E)-3-[[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-ethylamino]-3-oxoprop-1-enyl]benzoate (PubChem CID 9094543) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is methyl 4-[(E)-3-[[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-ethylamino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-ethylamino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 9094543 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | methyl 4-[(E)-3-[[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-ethylamino]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCN(CC(=O)N[C@@H]1CCS(=O)(=O)C1)C(=O)/C=C/c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H24N2O6S/c1-3-21(12-17(22)20-16-10-11-28(25,26)13-16)18(23)9-6-14-4-7-15(8-5-14)19(24)27-2/h4-9,16H,3,10-13H2,1-2H3,(H,20,22)/b9-6+/t16-/m1/s1 |
| InChIKey | IZTHGFGSUANVDH-YXMGTMDOSA-N |
| XLogP | 0.64 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|