C19H26N2O6S — CID 9094557
(E)-3-(2,5-dimethoxyphenyl)-N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 9094557) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 9094557 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)N[C@@H]1CCS(=O)(=O)C1)C(=O)/C=C/c1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H26N2O6S/c1-4-21(12-18(22)20-15-9-10-28(24,25)13-15)19(23)8-5-14-11-16(26-2)6-7-17(14)27-3/h5-8,11,15H,4,9-10,12-13H2,1-3H3,(H,20,22)/b8-5+/t15-/m1/s1 |
| InChIKey | ZCBNLRPAHXGOMO-SBJJXXPASA-N |
| XLogP | 0.87 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|