C9H19N3O2S — CID 62361732
1-(1,1-dioxothiolan-3-yl)-2-(2-methylpropyl)guanidine (PubChem CID 62361732) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-(2-methylpropyl)guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 62361732 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(\N)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19N3O2S/c1-7(2)5-11-9(10)12-8-3-4-15(13,14)6-8/h7-8H,3-6H2,1-2H3,(H3,10,11,12) |
| InChIKey | WRVPYMPYXUIDQV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|