C12H21N3O4S — CID 95271977
(3R)-3-acetamido-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-1-carboxamide (PubChem CID 95271977) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is (3R)-3-acetamido-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-acetamido-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95271977 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (3R)-3-acetamido-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-1-carboxamide |
| SMILES | CC(=O)N[C@@H]1CCCN(C(=O)N[C@@H]2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C12H21N3O4S/c1-9(16)13-10-3-2-5-15(7-10)12(17)14-11-4-6-20(18,19)8-11/h10-11H,2-8H2,1H3,(H,13,16)(H,14,17)/t10-,11-/m1/s1 |
| InChIKey | ALPLOVGPXNGVJD-GHMZBOCLSA-N |
| XLogP | -0.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |