C11H20N2O3S — CID 2424807
N-[(3S)-1,1-dioxothiolan-3-yl]azepane-1-carboxamide (PubChem CID 2424807) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]azepane-1-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 2424807 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]azepane-1-carboxamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)N1CCCCCC1 |
| InChI | InChI=1S/C11H20N2O3S/c14-11(13-6-3-1-2-4-7-13)12-10-5-8-17(15,16)9-10/h10H,1-9H2,(H,12,14)/t10-/m0/s1 |
| InChIKey | JFSYAZFVJXQHRJ-JTQLQIEISA-N |
| XLogP | 0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |