C14H18ClNO3S — CID 56824101
N-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 56824101) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is N-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 56824101 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[(3-chloro-4-prop-2-enoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | C=CCOc1ccc(CNC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C14H18ClNO3S/c1-2-6-19-14-4-3-11(8-13(14)15)9-16-12-5-7-20(17,18)10-12/h2-4,8,12,16H,1,5-7,9-10H2 |
| InChIKey | JILHULBNQQYJJH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|