C12H15F2NO2S — CID 43614880
N-[(2,5-difluorophenyl)methyl]-1,1-dioxothian-4-amine (PubChem CID 43614880) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43614880 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(NCc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C12H15F2NO2S/c13-10-1-2-12(14)9(7-10)8-15-11-3-5-18(16,17)6-4-11/h1-2,7,11,15H,3-6,8H2 |
| InChIKey | LFYVZNATUKBNLB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |