C13H17F2NO3S — CID 60910082
1-(2,5-difluorophenyl)-2-[(1,1-dioxothian-4-yl)amino]ethanol (PubChem CID 60910082) has the molecular formula C13H17F2NO3S and a molecular weight of 305.35 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[(1,1-dioxothian-4-yl)amino]ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-[(1,1-dioxothian-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 60910082 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[(1,1-dioxothian-4-yl)amino]ethanol |
| SMILES | O=S1(=O)CCC(NCC(O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C13H17F2NO3S/c14-9-1-2-12(15)11(7-9)13(17)8-16-10-3-5-20(18,19)6-4-10/h1-2,7,10,13,16-17H,3-6,8H2 |
| InChIKey | ZHWGMUAXMSGMDN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |