C12H15F2NO3S — CID 79891410
4-[[(1,1-dioxothian-4-yl)amino]methyl]-2,6-difluorophenol (PubChem CID 79891410) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-[[(1,1-dioxothian-4-yl)amino]methyl]-2,6-difluorophenol.
| Compound Name | 4-[[(1,1-dioxothian-4-yl)amino]methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79891410 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-[[(1,1-dioxothian-4-yl)amino]methyl]-2,6-difluorophenol |
| SMILES | O=S1(=O)CCC(NCc2cc(F)c(O)c(F)c2)CC1 |
| InChI | InChI=1S/C12H15F2NO3S/c13-10-5-8(6-11(14)12(10)16)7-15-9-1-3-19(17,18)4-2-9/h5-6,9,15-16H,1-4,7H2 |
| InChIKey | XZHXYJVTHSXKPR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |