C12H16F2N2 — CID 63051609
4-[(cyclopropylamino)methyl]-2,6-difluoro-N,N-dimethylaniline (PubChem CID 63051609) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-2,6-difluoro-N,N-dimethylaniline.
| Compound Name | 4-[(cyclopropylamino)methyl]-2,6-difluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 63051609 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-2,6-difluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1c(F)cc(CNC2CC2)cc1F |
| InChI | InChI=1S/C12H16F2N2/c1-16(2)12-10(13)5-8(6-11(12)14)7-15-9-3-4-9/h5-6,9,15H,3-4,7H2,1-2H3 |
| InChIKey | AWQBDGKHKHGCRA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|