C15H20F2N2 — CID 63051957
N-cyclopropyl-4-[(cyclopropylamino)methyl]-N-ethyl-2,6-difluoroaniline (PubChem CID 63051957) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is N-cyclopropyl-4-[(cyclopropylamino)methyl]-N-ethyl-2,6-difluoroaniline.
| Compound Name | N-cyclopropyl-4-[(cyclopropylamino)methyl]-N-ethyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 63051957 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-cyclopropyl-4-[(cyclopropylamino)methyl]-N-ethyl-2,6-difluoroaniline |
| SMILES | CCN(c1c(F)cc(CNC2CC2)cc1F)C1CC1 |
| InChI | InChI=1S/C15H20F2N2/c1-2-19(12-5-6-12)15-13(16)7-10(8-14(15)17)9-18-11-3-4-11/h7-8,11-12,18H,2-6,9H2,1H3 |
| InChIKey | YVHGLGVJDLTJIO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|