C15H20ClF2N — CID 63540811
4-(chloromethyl)-N-cyclohexyl-N-ethyl-2,6-difluoroaniline (PubChem CID 63540811) has the molecular formula C15H20ClF2N and a molecular weight of 287.78 g/mol. Its IUPAC name is 4-(chloromethyl)-N-cyclohexyl-N-ethyl-2,6-difluoroaniline.
| Compound Name | 4-(chloromethyl)-N-cyclohexyl-N-ethyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 63540811 |
| Molecular Formula | C15H20ClF2N |
| Molecular Weight | 287.78 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-(chloromethyl)-N-cyclohexyl-N-ethyl-2,6-difluoroaniline |
| SMILES | CCN(c1c(F)cc(CCl)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C15H20ClF2N/c1-2-19(12-6-4-3-5-7-12)15-13(17)8-11(10-16)9-14(15)18/h8-9,12H,2-7,10H2,1H3 |
| InChIKey | QXVZOXMDCOBDDD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|