C10H11F2NO2S — CID 165451307
N-[(3,5-difluorophenyl)methyl]-1,1-dioxothietan-3-amine (PubChem CID 165451307) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-1,1-dioxothietan-3-amine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-1,1-dioxothietan-3-amine |
|---|---|
| PubChem CID | 165451307 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-1,1-dioxothietan-3-amine |
| SMILES | O=S1(=O)CC(NCc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C10H11F2NO2S/c11-8-1-7(2-9(12)3-8)4-13-10-5-16(14,15)6-10/h1-3,10,13H,4-6H2 |
| InChIKey | LCTWMKZFYPXPKU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |