C17H23F2N — CID 63793739
N-[(2,5-difluorophenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 63793739) has the molecular formula C17H23F2N and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 63793739 |
| Molecular Formula | C17H23F2N |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | Fc1ccc(F)c(CNC2CCC3CCCCC3C2)c1 |
| InChI | InChI=1S/C17H23F2N/c18-15-6-8-17(19)14(9-15)11-20-16-7-5-12-3-1-2-4-13(12)10-16/h6,8-9,12-13,16,20H,1-5,7,10-11H2 |
| InChIKey | YMHWIHDQCMKBRL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |