C12H13FN2O2S — CID 107903650
2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-4-fluorobenzonitrile (PubChem CID 107903650) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107903650 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13FN2O2S/c13-11-2-1-9(6-14)10(5-11)7-15-12-3-4-18(16,17)8-12/h1-2,5,12,15H,3-4,7-8H2 |
| InChIKey | UQNNYRPFFRRPJL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |