About 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile
2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile (PubChem CID 107904394) has the molecular formula C16H21FN2
and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile.
Molecular Properties
| Compound Name | 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile |
| PubChem CID | 107904394 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile |
| SMILES | CC1CCC(NCc2cc(F)ccc2C#N)CC1C |
| InChI | InChI=1S/C16H21FN2/c1-11-3-6-16(7-12(11)2)19-10-14-8-15(17)5-4-13(14)9-18/h4-5,8,11-12,16,19H,3,6-7,10H2,1-2H3 |
| InChIKey | WZTUTMIAQXOAIJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile?
The IUPAC name of 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile (CID 107904394) is 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile.
What is the SMILES notation for 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile?
The canonical SMILES for 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile is CC1CCC(NCc2cc(F)ccc2C#N)CC1C.
What is the InChIKey of 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile?
The InChIKey is WZTUTMIAQXOAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21FN2/c1-11-3-6-16(7-12(11)2)19-10-14-8-15(17)5-4-13(14)9-18/h4-5,8,11-12,16,19H,3,6-7,10H2,1-2H3.
What are the key properties of 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile?
2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile has a molecular weight of 260.36 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3,4-dimethylcyclohexyl)amino]methyl]-4-fluorobenzonitrile is sourced from PubChem (CID 107904394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).