C15H18F2N2 — CID 55236856
N-[(2,5-difluorophenyl)methyl]-1-prop-2-ynylpiperidin-4-amine (PubChem CID 55236856) has the molecular formula C15H18F2N2 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 55236856 |
| Molecular Formula | C15H18F2N2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(NCc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C15H18F2N2/c1-2-7-19-8-5-14(6-9-19)18-11-12-10-13(16)3-4-15(12)17/h1,3-4,10,14,18H,5-9,11H2 |
| InChIKey | PBUJXUXOMFXOIC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|