C16H20F2N2 — CID 43780397
N-[1-(2,4-difluorophenyl)ethyl]-1-prop-2-ynylpiperidin-4-amine (PubChem CID 43780397) has the molecular formula C16H20F2N2 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 43780397 |
| Molecular Formula | C16H20F2N2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(NC(C)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2/c1-3-8-20-9-6-14(7-10-20)19-12(2)15-5-4-13(17)11-16(15)18/h1,4-5,11-12,14,19H,6-10H2,2H3 |
| InChIKey | MVYBCXHYDCIRSF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|