C16H19F3N2 — CID 62881993
1-prop-2-ynyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine (PubChem CID 62881993) has the molecular formula C16H19F3N2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 1-prop-2-ynyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | 1-prop-2-ynyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 62881993 |
| Molecular Formula | C16H19F3N2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-prop-2-ynyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
| SMILES | C#CCN1CCC(NCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H19F3N2/c1-2-9-21-10-7-15(8-11-21)20-12-13-3-5-14(6-4-13)16(17,18)19/h1,3-6,15,20H,7-12H2 |
| InChIKey | YLDDGADDSDBBGW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|