C17H22F2N2O — CID 86777616
1-(2,2-difluoroethyl)-N-[(4-prop-2-ynoxyphenyl)methyl]piperidin-4-amine (PubChem CID 86777616) has the molecular formula C17H22F2N2O and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-[(4-prop-2-ynoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-[(4-prop-2-ynoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 86777616 |
| Molecular Formula | C17H22F2N2O |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-[(4-prop-2-ynoxyphenyl)methyl]piperidin-4-amine |
| SMILES | C#CCOc1ccc(CNC2CCN(CC(F)F)CC2)cc1 |
| InChI | InChI=1S/C17H22F2N2O/c1-2-11-22-16-5-3-14(4-6-16)12-20-15-7-9-21(10-8-15)13-17(18)19/h1,3-6,15,17,20H,7-13H2 |
| InChIKey | PXZVMMJQEDYEPL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|