C15H23FN2 — CID 103943629
1-ethyl-N-[(5-fluoro-2-methylphenyl)methyl]piperidin-4-amine (PubChem CID 103943629) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-ethyl-N-[(5-fluoro-2-methylphenyl)methyl]piperidin-4-amine.
| Compound Name | 1-ethyl-N-[(5-fluoro-2-methylphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 103943629 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-ethyl-N-[(5-fluoro-2-methylphenyl)methyl]piperidin-4-amine |
| SMILES | CCN1CCC(NCc2cc(F)ccc2C)CC1 |
| InChI | InChI=1S/C15H23FN2/c1-3-18-8-6-15(7-9-18)17-11-13-10-14(16)5-4-12(13)2/h4-5,10,15,17H,3,6-9,11H2,1-2H3 |
| InChIKey | FKDBZESRXZVROB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |