C12H16FN — CID 115968089
N-[(5-fluoro-2-methylphenyl)methyl]-2-methylcyclopropan-1-amine (PubChem CID 115968089) has the molecular formula C12H16FN and a molecular weight of 193.27 g/mol. Its IUPAC name is N-[(5-fluoro-2-methylphenyl)methyl]-2-methylcyclopropan-1-amine.
| Compound Name | N-[(5-fluoro-2-methylphenyl)methyl]-2-methylcyclopropan-1-amine |
|---|---|
| PubChem CID | 115968089 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-[(5-fluoro-2-methylphenyl)methyl]-2-methylcyclopropan-1-amine |
| SMILES | Cc1ccc(F)cc1CNC1CC1C |
| InChI | InChI=1S/C12H16FN/c1-8-3-4-11(13)6-10(8)7-14-12-5-9(12)2/h3-4,6,9,12,14H,5,7H2,1-2H3 |
| InChIKey | XPQOHMJYFPVOCH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |