C13H17N3O2S — CID 164633540
(3S)-1,1-dioxo-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)thian-3-amine (PubChem CID 164633540) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is (3S)-1,1-dioxo-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)thian-3-amine.
| Compound Name | (3S)-1,1-dioxo-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)thian-3-amine |
|---|---|
| PubChem CID | 164633540 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (3S)-1,1-dioxo-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)thian-3-amine |
| SMILES | O=S1(=O)CCC[C@H](NCc2cnn3ccccc23)C1 |
| InChI | InChI=1S/C13H17N3O2S/c17-19(18)7-3-4-12(10-19)14-8-11-9-15-16-6-2-1-5-13(11)16/h1-2,5-6,9,12,14H,3-4,7-8,10H2/t12-/m0/s1 |
| InChIKey | NNPWLLZLGSZXMX-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |