C12H20N2O5S — CID 119938524
dimethyl 2-[(2-thiomorpholin-3-ylacetyl)amino]butanedioate (PubChem CID 119938524) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is dimethyl 2-[(2-thiomorpholin-3-ylacetyl)amino]butanedioate.
| Compound Name | dimethyl 2-[(2-thiomorpholin-3-ylacetyl)amino]butanedioate |
|---|---|
| PubChem CID | 119938524 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | dimethyl 2-[(2-thiomorpholin-3-ylacetyl)amino]butanedioate |
| SMILES | COC(=O)CC(NC(=O)CC1CSCCN1)C(=O)OC |
| InChI | InChI=1S/C12H20N2O5S/c1-18-11(16)6-9(12(17)19-2)14-10(15)5-8-7-20-4-3-13-8/h8-9,13H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | NVXVFBPOTQHLDL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |